| id | C00026384 |
|---|---|
| Name | 3-(4-Hydroxyphenyl)quinoline |
| CAS RN | 107915-36-6 |
| Standard InChI | InChI=1S/C15H11NO/c17-14-7-5-11(6-8-14)13-9-12-3-1-2-4-15(12)16-10-13/h1-10,17H |
| Standard InChI (Main Layer) | InChI=1S/C15H11NO/c17-14-7-5-11(6-8-14)13-9-12-3-1-2-4-15(12)16-10-13/h1-10,17H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3168 |
| By standard InChI | CHEMBL407114 |
|---|---|
| By standard InChI Main Layer | CHEMBL407114 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Nitrariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Peganum nigellastrum | 673036 | Nitrariaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14061 | Estradiol 17-beta-dehydrogenase 1 | Enzyme | CHEMBL407114 |
CHEMBL929275
(1)
CHEMBL930252
(1)
|
0 / 0 |