| id | C00026389 |
|---|---|
| Name | N-Methyl-4-methoxycarbostyril / 4-Methoxy-1-methyl-2-quinolone / 1-Methyl-4-methoxy-2-quinolone |
| CAS RN | 32262-18-3 |
| Standard InChI | InChI=1S/C11H11NO2/c1-12-9-6-4-3-5-8(9)10(14-2)7-11(12)13/h3-7H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C11H11NO2/c1-12-9-6-4-3-5-8(9)10(14-2)7-11(12)13/h3-7H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3424 |
| By standard InChI | CHEMBL402069 |
|---|---|
| By standard InChI Main Layer | CHEMBL402069 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 5 |
| family name | count |
|---|---|
| Rutaceae | 5 |
| Pyrenulaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Casimiroa edulis | 68535 | Rutaceae | rosids | Viridiplantae |
| Clausena lansium | 159037 | Rutaceae | rosids | Viridiplantae |
| Hesperethusa crenulata | 200540 | Rutaceae | rosids | Viridiplantae |
| Pyrenula japonica | 146308 | Pyrenulaceae | Fungi | |
| Ruta montana | 266085 | Rutaceae | rosids | Viridiplantae |
| Toddalia asiatica | 159068 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL402069 |
CHEMBL1794483
(1)
|
0 / 0 |
| P01215 | Glycoprotein hormones alpha chain | Unclassified protein | CHEMBL402069 |
CHEMBL2114913
(1)
|
0 / 3 |