| id | C00026397 |
|---|---|
| Name | 7-(O-Acetyl)haplophyllidine |
| CAS RN | 23107-57-5 |
| Standard InChI | InChI=1S/C20H25NO5/c1-12(2)8-10-20(24-5)16(26-13(3)22)7-6-14-17(23-4)15-9-11-25-19(15)21-18(14)20/h8-9,11,16H,6-7,10H2,1-5H3/t16-,20+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H25NO5/c1-12(2)8-10-20(24-5)16(26-13(3)22)7-6-14-17(23-4)15-9-11-25-19(15)21-18(14)20/h8-9,11,16H,6-7,10H2,1-5H3 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 1718 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1880744 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Almeidia coerulea |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1880744 |
CHEMBL2114788
(1)
|
0 / 0 |