| id | C00026401 | 
|---|---|
| Name | Acetylhaplophyllidine | 
| CAS RN | 23107-57-5 | 
| Standard InChI | InChI=1S/C20H25NO5/c1-12(2)8-10-20(24-5)16(26-13(3)22)7-6-14-17(23-4)15-9-11-25-19(15)21-18(14)20/h8-9,11,16H,6-7,10H2,1-5H3/t16-,20+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H25NO5/c1-12(2)8-10-20(24-5)16(26-13(3)22)7-6-14-17(23-4)15-9-11-25-19(15)21-18(14)20/h8-9,11,16H,6-7,10H2,1-5H3 | 
| Phytochemical cluster | No. 7 | 
|---|---|
| KCF-S cluster | No. 1718 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1880744 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 1 | 
| family name | count | 
|---|---|
| Hypericaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Hypericum perforatum | 65561 | Hypericaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1880744 | CHEMBL2114788
                        (1) | 0 / 0 |