| id | C00026475 | 
|---|---|
| Name | Perfamine / (+)-Perfamine | 
| CAS RN | 59557-95-8 | 
| Standard InChI | InChI=1S/C18H19NO4/c1-11(2)7-9-18(22-4)14(20)6-5-12-15(21-3)13-8-10-23-17(13)19-16(12)18/h5-8,10H,9H2,1-4H3 | 
| Standard InChI (Main Layer) | InChI=1S/C18H19NO4/c1-11(2)7-9-18(22-4)14(20)6-5-12-15(21-3)13-8-10-23-17(13)19-16(12)18/h5-8,10H,9H2,1-4H3 | 
| Phytochemical cluster | No. 7 | 
|---|---|
| KCF-S cluster | No. 1718 | 
| By standard InChI | CHEMBL1543862 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1543862 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Haplophyllum glabrinum | 266078 | Rutaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1543862 | CHEMBL1614458
                        (1) | 0 / 0 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1543862 | CHEMBL1794483
                        (1) | 0 / 0 |