| id | C00026475 |
|---|---|
| Name | Perfamine / (+)-Perfamine |
| CAS RN | 59557-95-8 |
| Standard InChI | InChI=1S/C18H19NO4/c1-11(2)7-9-18(22-4)14(20)6-5-12-15(21-3)13-8-10-23-17(13)19-16(12)18/h5-8,10H,9H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H19NO4/c1-11(2)7-9-18(22-4)14(20)6-5-12-15(21-3)13-8-10-23-17(13)19-16(12)18/h5-8,10H,9H2,1-4H3 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 1718 |
| By standard InChI | CHEMBL1543862 |
|---|---|
| By standard InChI Main Layer | CHEMBL1543862 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Haplophyllum glabrinum | 266078 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1543862 |
CHEMBL1614458
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1543862 |
CHEMBL1794483
(1)
|
0 / 0 |