| id | C00002660 |
|---|---|
| Name | 4-Methylcatechol |
| CAS RN | 452-86-8 |
| Standard InChI | InChI=1S/C7H8O2/c1-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C7H8O2/c1-5-2-3-6(8)7(9)4-5/h2-4,8-9H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1546 |
| By standard InChI | CHEMBL158766 |
|---|---|
| By standard InChI Main Layer | CHEMBL158766 |
| By LinkDB | C06730 |
|---|
| By CAS RN | C018599 |
|---|
| class name | count |
|---|---|
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Pinaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Picea abies | 3329 | Pinaceae | Spermatophyta | Viridiplantae |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C018599 | 1312 |
COMT
|
catechol-O-methyltransferase (EC:2.1.1.6) | COMT protein results in increased methylation of 4-methylcatechol |
increases methylation
|
protein |
11160877
|