id | C00002661 |
---|---|
Name | Orcinol |
CAS RN | 504-15-4 |
Standard InChI | InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1546 |
By standard InChI | CHEMBL110059 |
---|---|
By standard InChI Main Layer | CHEMBL110059 |
By LinkDB | C00727 |
---|
By CAS RN | C005282 |
---|
class name | count |
---|---|
asterids | 3 |
eudicotyledons | 1 |
family name | count |
---|---|
Ericaceae | 2 |
Asteraceae | 1 |
Amaranthaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Amaranthus hypochondriacus | 28502 | Amaranthaceae | eudicotyledons | Viridiplantae |
Dittrichia viscosa | 56525 | Asteraceae | asterids | Viridiplantae |
Erica arborea | 270431 | Ericaceae | asterids | Viridiplantae |
Rhododendron dauricum | 880079 | Ericaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P14679 | Tyrosinase | Oxidoreductase | CHEMBL110059 |
CHEMBL2344046
(1)
CHEMBL2344048
(1)
CHEMBL2344050 (1) CHEMBL2344052 (1) |
4 / 2 |