| id | C00002662 |
|---|---|
| Name | 5-Pentadecylresorcinol |
| CAS RN | 3158-56-3 |
| Standard InChI | InChI=1S/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-20(22)18-21(23)17-19/h16-18,22-23H,2-15H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-20(22)18-21(23)17-19/h16-18,22-23H,2-15H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 652 |
| By standard InChI | CHEMBL98610 |
|---|---|
| By standard InChI Main Layer | CHEMBL98610 |
| By LinkDB | C10809 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Anacardiaceae | 1 |
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Mangifera indica | 29780 | Anacardiaceae | rosids | Viridiplantae |
| Streptomyces cyaneus 2007-SV1 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL98610 |
CHEMBL980220
(1)
|
0 / 0 |
| P00734 | Prothrombin | S1A | CHEMBL98610 |
CHEMBL976587
(1)
|
4 / 2 |