| id | C00026715 |
|---|---|
| Name | Tuberostemonine J / (+)-Tuberostemonine J / (9alpa,9aalpha)-Neotuberostemonin |
| CAS RN | 670254-75-8 |
| Standard InChI | InChI=1S/C22H33NO4/c1-4-13-14-7-5-6-8-23-16(17-9-11(2)21(24)26-17)10-15(19(14)23)18-12(3)22(25)27-20(13)18/h11-20H,4-10H2,1-3H3/t11-,12-,13+,14-,15-,16-,17-,18-,19-,20+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H33NO4/c1-4-13-14-7-5-6-8-23-16(17-9-11(2)21(24)26-17)10-15(19(14)23)18-12(3)22(25)27-20(13)18/h11-20H,4-10H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 733 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL517375 CHEMBL479493 CHEMBL1317235 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Stemonaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stemona tuberosa | 167572 | Stemonaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1317235 |
CHEMBL1614110
(1)
|
1 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1317235 |
CHEMBL1614227
(1)
|
3 / 3 |