| id | C00026716 | 
|---|---|
| Name | Tuberostemonine H / (+)-Tuberostemonine H / (9alpha)-Neotuberostemonine | 
| CAS RN | 670254-76-9 | 
| Standard InChI | InChI=1S/C22H33NO4/c1-4-13-14-7-5-6-8-23-16(17-9-11(2)21(24)26-17)10-15(19(14)23)18-12(3)22(25)27-20(13)18/h11-20H,4-10H2,1-3H3/t11-,12-,13+,14-,15-,16-,17-,18-,19-,20+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C22H33NO4/c1-4-13-14-7-5-6-8-23-16(17-9-11(2)21(24)26-17)10-15(19(14)23)18-12(3)22(25)27-20(13)18/h11-20H,4-10H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 733 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL517375 CHEMBL479493 CHEMBL1317235 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Stemonaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Stemona tuberosa | 167572 | Stemonaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1317235 | 
                        CHEMBL1614110
                        (1)
                         | 
                      1 / 0 | 
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1317235 | 
                        CHEMBL1614227
                        (1)
                         | 
                      3 / 3 |