| id | C00002673 | 
|---|---|
| Name | Sesamol | 
| CAS RN | 533-31-3 | 
| Standard InChI | InChI=1S/C7H6O3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3,8H,4H2 | 
| Standard InChI (Main Layer) | InChI=1S/C7H6O3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3,8H,4H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4093 | 
| By standard InChI | CHEMBL1517998 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1517998 | 
| By LinkDB | C10832 | 
|---|
| By CAS RN | C025583 | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Pedaliaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Sesamum indicum | 4182 | Pedaliaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL1517998 | CHEMBL1794510
                        (1) | 5 / 3 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1517998 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| P10275 | Androgen receptor | NR3C4 | CHEMBL1517998 | CHEMBL1794321
                        (1)
                        CHEMBL1794560
                        (1) | 3 / 4 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300068 | Androgen insensitivity syndrome; ais | P10275 | 
| #312300 | Androgen insensitivity, partial; pais | P10275 | 
| %606641 | Body mass index; bmi | P37231 | 
| #609338 | Carotid intimal medial thickness 1 | P37231 | 
| #137800 | Glioma susceptibility 1; glm1 | P37231 | 
| #604367 | Lipodystrophy, familial partial, type 3; fpld3 | P37231 | 
| #601665 | Obesity | P37231 | 
| #313200 | Spinal and bulbar muscular atrophy, x-linked 1; smax1 | P10275 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00024 | Prostate cancer | P10275
                            (related) | 
| H00062 | Spinal and bulbar muscular atrophy (SBMA) | P10275
                            (related) | 
| H00608 | 46,XY disorders of sex development (Disorders in androgen synthesis or action) | P10275
                            (related) | 
| H00609 | 46,XY disorders of sex development (Other) | P10275
                            (related) | 
| H00032 | Thyroid cancer | P37231
                            (related) | 
| H00409 | Type II diabetes mellitus | P37231
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P37231
                            (related) |