| id | C00026840 |
|---|---|
| Name | meso-Chimonanthine |
| CAS RN | 4147-37-9 |
| Standard InChI | InChI=1S/C22H26N4/c1-25-13-11-21(15-7-3-5-9-17(15)23-19(21)25)22-12-14-26(2)20(22)24-18-10-6-4-8-16(18)22/h3-10,19-20,23-24H,11-14H2,1-2H3/t19-,20+,21+,22- |
| Standard InChI (Main Layer) | InChI=1S/C22H26N4/c1-25-13-11-21(15-7-3-5-9-17(15)23-19(21)25)22-12-14-26(2)20(22)24-18-10-6-4-8-16(18)22/h3-10,19-20,23-24H,11-14H2,1-2H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 1028 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL464977 CHEMBL1895573 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Rubiaceae | 2 |
| Calycanthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chimonanthus fragrans | 13418 | Calycanthaceae | Magnoliophyta | Viridiplantae |
| Psychotria forsteriana | 1277318 | Rubiaceae | asterids | Viridiplantae |
| Psychotria lyciiflora | 1277320 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL1895573 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1895573 |
CHEMBL2114931
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1895573 |
CHEMBL1794483
(1)
|
0 / 0 |