| id | C00026878 |
|---|---|
| Name | Microcin SF608 |
| CAS RN | 248582-51-6 |
| Standard InChI | InChI=1S/C32H44N6O6/c33-32(34)36-15-5-4-14-35-29(42)27-18-22-10-13-24(40)19-26(22)38(27)31(44)25(16-20-6-2-1-3-7-20)37-30(43)28(41)17-21-8-11-23(39)12-9-21/h1-3,6-9,11-12,22,24-28,39-41H,4-5,10,13-19H2,(H,35,42)(H,37,43)(H4,33,34,36)/t22-,24+,25-,26-,27-,28-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C32H44N6O6/c33-32(34)36-15-5-4-14-35-29(42)27-18-22-10-13-24(40)19-26(22)38(27)31(44)25(16-20-6-2-1-3-7-20)37-30(43)28(41)17-21-8-11-23(39)12-9-21/h1-3,6-9,11-12,22,24-28,39-41H,4-5,10,13-19H2,(H,35,42)(H,37,43)(H4,33,34,36) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2841 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2011686 CHEMBL2011687 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Microcystis aeruginosa | 1126 | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00734 | Prothrombin | S1A | CHEMBL2011686 CHEMBL2011687 |
CHEMBL2014078
(1)
CHEMBL2014083
(1)
|
4 / 2 |