| id | C00002691 |
|---|---|
| Name | Aspidinol |
| CAS RN | 519-40-4 |
| Standard InChI | InChI=1S/C12H16O4/c1-4-5-8(13)11-9(14)6-10(16-3)7(2)12(11)15/h6,14-15H,4-5H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C12H16O4/c1-4-5-8(13)11-9(14)6-10(16-3)7(2)12(11)15/h6,14-15H,4-5H2,1-3H3 |
| Phytochemical cluster | No. 67 |
|---|---|
| KCF-S cluster | No. 7614 |
| By standard InChI | CHEMBL214690 |
|---|---|
| By standard InChI Main Layer | CHEMBL214690 |
| By LinkDB | C10673 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Euphyllophyta | 3 |
| family name | count |
|---|---|
| Athyriaceae | 1 |
| Dryopteridaceae | 1 |
| Polypodiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aspidium filix-mas | 3275 | Polypodiaceae | Euphyllophyta | Viridiplantae |
| Athyrium filix-femina | 32110 | Athyriaceae | Euphyllophyta | Viridiplantae |
| Dryopteris austriaca | 1091247 | Dryopteridaceae | Euphyllophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49327 | Fatty acid synthase | Transferase | CHEMBL214690 |
CHEMBL862461
(1)
|
0 / 0 |