| id | C00027005 |
|---|---|
| Name | Moschamine / (E)-Moschamine |
| CAS RN | 193224-22-5 |
| Standard InChI | InChI=1S/C20H20N2O4/c1-26-19-10-13(2-6-18(19)24)3-7-20(25)21-9-8-14-12-22-17-5-4-15(23)11-16(14)17/h2-7,10-12,22-24H,8-9H2,1H3,(H,21,25)/b7-3+ |
| Standard InChI (Main Layer) | InChI=1S/C20H20N2O4/c1-26-19-10-13(2-6-18(19)24)3-7-20(25)21-9-8-14-12-22-17-5-4-15(23)11-16(14)17/h2-7,10-12,22-24H,8-9H2,1H3,(H,21,25) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1533 |
| By standard InChI | CHEMBL564482 |
|---|---|
| By standard InChI Main Layer | CHEMBL564482 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Centaurea cyanus | 41522 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL564482 |
CHEMBL2016144
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL564482 |
CHEMBL2016143
(1)
|
0 / 0 |
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL564482 |
CHEMBL1064098
(1)
|
4 / 2 |