| id | C00027305 |
|---|---|
| Name | Bracteoline |
| CAS RN | 25651-04-1 |
| Standard InChI | InChI=1S/C19H21NO4/c1-20-5-4-10-7-16(24-3)19(22)18-12-9-14(21)15(23-2)8-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C19H21NO4/c1-20-5-4-10-7-16(24-3)19(22)18-12-9-14(21)15(23-2)8-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 20 |
| By standard InChI | CHEMBL1316470 |
|---|---|
| By standard InChI Main Layer | CHEMBL410604 CHEMBL1316470 |
| By LinkDB | C09366 |
|---|
| By CAS RN | C002507 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Papaveraceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Corydalis gortschakovii | 3463 | Papaveraceae | eudicotyledons | Viridiplantae |
| Papaver orientale | 22694 | Papaveraceae | eudicotyledons | Viridiplantae |
| Papaver pseudo-orientale | 215228 | Papaveraceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1316470 |
CHEMBL1614110
(1)
|
1 / 0 |
| P04637 | Cellular tumor antigen p53 | Transcription Factor | CHEMBL1316470 |
CHEMBL1613995
(1)
|
7 / 44 |
| P29466 | Caspase-1 | C14 | CHEMBL1316470 |
CHEMBL1614158
(1)
|
0 / 0 |
| P34969 | 5-hydroxytryptamine receptor 7 | Serotonin receptor | CHEMBL410604 |
CHEMBL886703
(1)
|
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1316470 |
CHEMBL1614027
(1)
|
0 / 1 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1316470 |
CHEMBL1614458
(1)
|
0 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1316470 |
CHEMBL1613910
(1)
CHEMBL1614227
(1)
|
3 / 3 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL1316470 |
CHEMBL1614038
(1)
|
2 / 2 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1316470 |
CHEMBL1613777
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1316470 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1316470 |
CHEMBL1614250
(1)
CHEMBL1614421
(1)
CHEMBL1614502 (1) |
4 / 3 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1316470 |
CHEMBL1794536
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1316470 |
CHEMBL1613914
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #202300 | Adrenocortical carcinoma, hereditary; adcc |
P04637
|
| #614740 | Basal cell carcinoma, susceptibility to, 7; bcc7 |
P04637
|
| #119900 | Digital clubbing, isolated congenital |
P15428
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #133239 | Esophageal cancer |
P04637
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 |
P15428
|
| #151623 | Li-fraumeni syndrome 1; lfs1 |
P04637
|
| #211980 | Lung cancer |
P04637
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #260500 | Papilloma of choroid plexus; cpp |
P04637
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #275355 | Squamous cell carcinoma, head and neck; hnscc |
P04637
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00004 | Chronic myeloid leukemia (CML) |
P04637
(related)
|
| H00005 | Chronic lymphocytic leukemia (CLL) |
P04637
(related)
|
| H00006 | Hairy-cell leukemia |
P04637
(related)
|
| H00008 | Burkitt lymphoma |
P04637
(related)
|
| H00009 | Adult T-cell leukemia |
P04637
(related)
|
| H00010 | Multiple myeloma |
P04637
(related)
|
| H00013 | Small cell lung cancer |
P04637
(related)
|
| H00014 | Non-small cell lung cancer |
P04637
(related)
|
| H00015 | Malignant pleural mesothelioma |
P04637
(related)
|
| H00016 | Oral cancer |
P04637
(related)
P04637 (marker) |
| H00017 | Esophageal cancer |
P04637
(related)
P04637 (marker) |
| H00018 | Gastric cancer |
P04637
(related)
|
| H00019 | Pancreatic cancer |
P04637
(related)
P04637 (marker) |
| H00020 | Colorectal cancer |
P04637
(related)
P04637 (marker) |
| H00022 | Bladder cancer |
P04637
(related)
|
| H00025 | Penile cancer |
P04637
(related)
P04637 (marker) |
| H00026 | Endometrial Cancer |
P04637
(related)
|
| H00027 | Ovarian cancer |
P04637
(related)
|
| H00028 | Choriocarcinoma |
P04637
(related)
|
| H00029 | Vulvar cancer |
P04637
(related)
|
| H00031 | Breast cancer |
P04637
(related)
|
| H00032 | Thyroid cancer |
P04637
(related)
|
| H00033 | Adrenal carcinoma |
P04637
(related)
|
| H00036 | Osteosarcoma |
P04637
(related)
P08684 (marker) |
| H00038 | Malignant melanoma |
P04637
(related)
|
| H00039 | Basal cell carcinoma |
P04637
(related)
|
| H00040 | Squamous cell carcinoma |
P04637
(related)
|
| H00041 | Kaposi's sarcoma |
P04637
(related)
|
| H00042 | Glioma |
P04637
(related)
P04637 (marker) |
| H00044 | Cancer of the anal canal |
P04637
(related)
|
| H00046 | Cholangiocarcinoma |
P04637
(related)
|
| H00047 | Gallbladder cancer |
P04637
(related)
|
| H00048 | Hepatocellular carcinoma |
P04637
(related)
|
| H00055 | Laryngeal cancer |
P04637
(related)
P04637 (marker) |
| H00881 | Li-Fraumeni syndrome |
P04637
(related)
|
| H01007 | Choroid plexus papilloma |
P04637
(related)
|
| H00021 | Renal cell carcinoma |
P04637
(marker)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00457 | Primary hypertrophic osteoarthropathy (PHO) |
P15428
(related)
|
| H01246 | Isolated congenital nail clubbing (ICNC) |
P15428
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
Q99714
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|