| id | C00027451 |
|---|---|
| Name | O-Methylcorypalline |
| CAS RN | 16620-96-5 |
| Standard InChI | InChI=1S/C12H17NO2/c1-13-5-4-9-6-11(14-2)12(15-3)7-10(9)8-13/h6-7H,4-5,8H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C12H17NO2/c1-13-5-4-9-6-11(14-2)12(15-3)7-10(9)8-13/h6-7H,4-5,8H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 1686 |
| By standard InChI | CHEMBL1196025 |
|---|---|
| By standard InChI Main Layer | CHEMBL1196025 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Cactaceae | 1 |
| Nelumbonaceae | 1 |
| Berberidaceae | 1 |
| Lauraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Berberis densiflora | 22774 | Berberidaceae | eudicotyledons | Viridiplantae |
| Nelumbo nucifera Gaertn. | 4432 | Nelumbonaceae | eudicotyledons | Viridiplantae |
| Phoebe minutiflora | 1053126 | Lauraceae | Magnoliophyta | Viridiplantae |
| Pilocereus guerroronis | 3593 | Cactaceae | eudicotyledons | Viridiplantae |