| id | C00027527 |
|---|---|
| Name | Cephatonine / (-)-Cephatonine |
| CAS RN | 175862-78-9 |
| Standard InChI | InChI=1S/C21H23NO5/c1-22-7-6-12-8-17(24-2)15(23)9-14(12)21(25-3)10-13-4-5-16-19(27-11-26-16)18(13)20(21)22/h4-5,8-9,20,23H,6-7,10-11H2,1-3H3/t20-,21+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H23NO5/c1-22-7-6-12-8-17(24-2)15(23)9-14(12)21(25-3)10-13-4-5-16-19(27-11-26-16)18(13)20(21)22/h4-5,8-9,20,23H,6-7,10-11H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 512 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Menispermaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stephania cepharantha | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |
| Stephania longa | 147244 | Menispermaceae | eudicotyledons | Viridiplantae |