id | C00002788 |
---|---|
Name | Alkannin beta,beta-dimethylacrylate |
CAS RN | 5162-01-6 |
Standard InChI | InChI=1S/C21H22O6/c1-11(2)5-8-17(27-18(25)9-12(3)4)13-10-16(24)19-14(22)6-7-15(23)20(19)21(13)26/h5-7,9-10,17,22-23H,8H2,1-4H3/t17-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C21H22O6/c1-11(2)5-8-17(27-18(25)9-12(3)4)13-10-16(24)19-14(22)6-7-15(23)20(19)21(13)26/h5-7,9-10,17,22-23H,8H2,1-4H3 |
Phytochemical cluster | No. 80 |
---|---|
KCF-S cluster | No. 2968 |
By standard InChI | CHEMBL513640 |
---|---|
By standard InChI Main Layer | CHEMBL267024 CHEMBL513640 |
By LinkDB | C10293 |
---|
By CAS RN | C032573 |
---|
class name | count |
---|---|
asterids | 1 |
family name | count |
---|---|
Boraginaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Arnebia nobilis | 373121 | Boraginaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL267024 |
CHEMBL663903
(1)
|
0 / 0 |