| id | C00002791 | 
|---|---|
| Name | Altersolanol A | 
| CAS RN | 22268-16-2 | 
| Standard InChI | InChI=1S/C16H16O8/c1-16(23)14(21)10-9(13(20)15(16)22)12(19)8-6(11(10)18)3-5(24-2)4-7(8)17/h3-4,13-15,17,20-23H,1-2H3/t13-,14+,15+,16-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C16H16O8/c1-16(23)14(21)10-9(13(20)15(16)22)12(19)8-6(11(10)18)3-5(24-2)4-7(8)17/h3-4,13-15,17,20-23H,1-2H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2024 | 
| By standard InChI | CHEMBL512054 | 
|---|---|
| By standard InChI Main Layer | CHEMBL512054 | 
| By LinkDB | C10296 | 
|---|
| By CAS RN | C058812 | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Pleosporaceae | 2 | 
| Poaceae | 1 | 
| Davidiellaceae | 1 | 
| Valsaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Ampelomyces sp. | ||||
| Cladosporium sp. | 5498 | Davidiellaceae | Fungi | |
| Dactylaria lutea | ||||
| Dactylis lutea | 4508 | Poaceae | Liliopsida | Viridiplantae | 
| Phomopsis juniperovora | 34399 | Valsaceae | Fungi | |
| Stemphylium botryosum var. lactucum | 95729 | Pleosporaceae | Fungi | |
| Stemphylium globuliferum | 245170 | Pleosporaceae | Fungi | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P08069 | Insulin-like growth factor 1 receptor | TK tyrosine-protein kinase INSR subfamily | CHEMBL512054 | CHEMBL1026230
                        (1) | 1 / 3 | 
| O14965 | Aurora kinase A | Aur | CHEMBL512054 | CHEMBL1026220
                        (1) | 0 / 0 | 
| P68400 | Casein kinase II subunit alpha | Ck2 | CHEMBL512054 | CHEMBL1026239
                        (1) | 0 / 0 | 
| P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL512054 | CHEMBL1026223
                        (1) | 0 / 0 | 
| O00444 | Serine/threonine-protein kinase PLK4 | PLK serine/threonine protein kinase subfamily | CHEMBL512054 | CHEMBL1026240
                        (1) | 0 / 0 | 
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL512054 | CHEMBL1026226
                        (1) | 1 / 11 | 
| P36888 | Receptor-type tyrosine-protein kinase FLT3 | Pdgfr | CHEMBL512054 | CHEMBL1026234
                        (1) | 1 / 1 | 
| P54760 | Ephrin type-B receptor 4 | Eph | CHEMBL512054 | CHEMBL1026227
                        (1) | 0 / 0 | 
| Q05397 | Focal adhesion kinase 1 | Fak | CHEMBL512054 | CHEMBL1026229
                        (1) | 0 / 0 | 
| Q02763 | Angiopoietin-1 receptor | Tie | CHEMBL512054 | CHEMBL1026243
                        (1) | 1 / 1 | 
| O60285 | NUAK family SNF1-like kinase 1 | CAMK serine/threonine protein kinase NUAK subfamily | CHEMBL512054 | CHEMBL1026219
                        (1) | 0 / 0 | 
| P06213 | Insulin receptor | TK tyrosine-protein kinase INSR subfamily | CHEMBL512054 | CHEMBL1026235
                        (1) | 5 / 4 | 
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL512054 | CHEMBL1026228
                        (1) | 5 / 10 | 
| P09619 | Platelet-derived growth factor receptor beta | Pdgfr | CHEMBL512054 | CHEMBL1026237
                        (1) | 5 / 1 | 
| P12931 | Proto-oncogene tyrosine-protein kinase Src | Src | CHEMBL512054 | CHEMBL1026231
                        (1) | 0 / 0 | 
| Q96GD4 | Aurora kinase B | Aur | CHEMBL512054 | CHEMBL1026221
                        (1) | 0 / 0 | 
| P35968 | Vascular endothelial growth factor receptor 2 | Vegfr | CHEMBL512054 | CHEMBL1026232
                        (1) | 1 / 0 | 
| P08581 | Hepatocyte growth factor receptor | TK tyrosine-protein kinase MET subfamily | CHEMBL512054 | CHEMBL1026236
                        (1) | 2 / 3 | 
| P35916 | Vascular endothelial growth factor receptor 3 | Vegfr | CHEMBL512054 | CHEMBL1026233
                        (1) | 2 / 1 | 
| P41279 | Mitogen-activated protein kinase kinase kinase 8 | Ste11 | CHEMBL512054 | CHEMBL1026225
                        (1) | 0 / 0 | 
| P53350 | Serine/threonine-protein kinase PLK1 | PLK serine/threonine protein kinase subfamily | CHEMBL512054 | CHEMBL1026238
                        (1) | 0 / 0 | 
| P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL512054 | CHEMBL1026218
                        (1) | 4 / 1 | 
| P11802 | Cyclin-dependent kinase 4 | CMGC serine/threonine protein kinase family | CHEMBL512054 | CHEMBL1026224
                        (1) | 1 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #615007 | Basal ganglia calcification, idiopathic, 4; ibgc4 | P09619 | 
| #114480 | Breast cancer | P31749 | 
| #114500 | Colorectal cancer; crc | P31749 | 
| #615109 | Cowden syndrome 6; cws6 | P31749 | 
| #610549 | Diabetes mellitus, insulin-resistant, with acanthosis nigricans | P06213 | 
| #125853 | Diabetes mellitus, noninsulin-dependent; niddm | P06213 | 
| #246200 | Donohue syndrome | P06213 | 
| #613659 | Gastric cancer | P04626 | 
| #137215 | Gastric cancer, hereditary diffuse; hdgc | P04626 | 
| #137800 | Glioma susceptibility 1; glm1 | P04626 | 
| #602089 | Hemangioma, capillary infantile | P35916 P35968 | 
| #114550 | Hepatocellular carcinoma | P08581 | 
| #609968 | Hyperinsulinemic hypoglycemia, familial, 5; hhf5 | P06213 | 
| #270450 | Insulin-like growth factor i, resistance to | P08069 | 
| #607785 | Juvenile myelomonocytic leukemia; jmml | P09619 | 
| #601626 | Leukemia, acute myeloid; aml | P09619 P36888 | 
| #211980 | Lung cancer | P00533 P04626 | 
| #153100 | Lymphedema, hereditary, ia | P35916 | 
| #609048 | Melanoma, cutaneous malignant, susceptibility to, 3; cmm3 | P11802 | 
| #131440 | Myeloproliferative disorder, chronic, with eosinophilia | P09619 | 
| #228550 | Myofibromatosis, infantile, 1; imf1 | P09619 | 
| #167000 | Ovarian cancer | P04626 | 
| #262190 | Pineal hyperplasia, insulin-resistant diabetes mellitus, and somatic abnormalities | P06213 | 
| #176920 | Proteus syndrome | P31749 | 
| #605074 | Renal cell carcinoma, papillary, 1; rccp1 | P08581 | 
| #600195 | Venous malformations, multiple cutaneous and mucosal; vmcm | Q02763 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00016 | Oral cancer | P00533
                            (related) P00533 (marker) | 
| H00017 | Esophageal cancer | P00533
                            (related) | 
| H00018 | Gastric cancer | P00533
                            (related) P04626 (related) P08581 (related) | 
| H00022 | Bladder cancer | P00533
                            (related) P04626 (related) | 
| H00028 | Choriocarcinoma | P00533
                            (related) P04626 (related) | 
| H00030 | Cervical cancer | P00533
                            (related) P04626 (related) P11802 (related) | 
| H00042 | Glioma | P00533
                            (related) P00533 (marker) P09619 (related) P11802 (related) | 
| H00055 | Laryngeal cancer | P00533
                            (related) P00533 (marker) | 
| H00019 | Pancreatic cancer | P04626
                            (related) | 
| H00026 | Endometrial Cancer | P04626
                            (related) | 
| H00027 | Ovarian cancer | P04626
                            (related) | 
| H00031 | Breast cancer | P04626
                            (related) P04626 (marker) | 
| H00046 | Cholangiocarcinoma | P04626
                            (related) P08581 (related) | 
| H00719 | Leprechaunism | P06213
                            (related) | 
| H00942 | Rabson-Mendenhall syndrome | P06213
                            (related) | 
| H01228 | Insulin-resistant diabetes mellitus with acanthosis nigricans (IRAN) | P06213
                            (related) | 
| H01267 | Familial hyperinsulinemic hypoglycemia (HHF) | P06213
                            (related) | 
| H00015 | Malignant pleural mesothelioma | P08069
                            (related) | 
| H00050 | Synovial sarcoma | P08069
                            (related) | 
| H01274 | Growth delay due to insulin-like growth factor I resistance | P08069
                            (related) | 
| H00021 | Renal cell carcinoma | P08581
                            (related) | 
| H00038 | Malignant melanoma | P11802
                            (related) | 
| H00539 | PTEN hamartoma tumor syndrome (PHTS) | P31749
                            (related) | 
| H00535 | Lymphedemas | P35916
                            (related) | 
| H00003 | Acute myeloid leukemia (AML) | P36888
                            (related) | 
| H00531 | Venous malformations | Q02763
                            (related) |