| id | C00028110 | 
|---|---|
| Name | Curacin D | 
| CAS RN | 164454-36-8 | 
| Standard InChI | InChI=1S/C22H33NOS/c1-4-13-20(24-3)15-12-10-8-6-5-7-9-11-14-19-17-25-22(23-19)21-16-18(21)2/h4-6,8,10-11,14,18-21H,1,7,9,12-13,15-17H2,2-3H3/b6-5+,10-8+,14-11-/t18-,19+,20-,21+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C22H33NOS/c1-4-13-20(24-3)15-12-10-8-6-5-7-9-11-14-19-17-25-22(23-19)21-16-18(21)2/h4-6,8,10-11,14,18-21H,1,7,9,12-13,15-17H2,2-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5280 | 
| By standard InChI | CHEMBL1714537 | 
|---|---|
| By standard InChI Main Layer | CHEMBL56309 CHEMBL1714537 | 
| By LinkDB | 
|---|
| By CAS RN | C116945 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria | ||
| Lyngya majuscula | ||||
| Symploca hydnoides | 207924 | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P04637 | Cellular tumor antigen p53 | Transcription Factor | CHEMBL1714537 | CHEMBL1738132
                        (1) | 7 / 44 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1714537 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P49798 | Regulator of G-protein signaling 4 | Unclassified protein | CHEMBL1714537 | CHEMBL1794499
                        (1) | 2 / 0 | 
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL1714537 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1714537 | CHEMBL1794311
                        (1) | 2 / 3 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1714537 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL1714537 | CHEMBL2114843
                        (1)
                        CHEMBL2114780
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1714537 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1714537 | CHEMBL1794401
                        (1) | 0 / 0 | 
| Q9HC16 | DNA dC->dU-editing enzyme APOBEC-3G | Enzyme | CHEMBL1714537 | CHEMBL1963863
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1714537 | CHEMBL1738184
                        (1)
                        CHEMBL2114908
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL1714537 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q13748 | Tubulin alpha-3C/D chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| P68366 | Tubulin alpha-4A chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q9H4B7 | Tubulin beta-1 chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 1 / 0 | 
| P04350 | Tubulin beta-4A chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 2 / 0 | 
| Q3ZCM7 | Tubulin beta-8 chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| P07437 | Tubulin beta chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q71U36 | Tubulin alpha-1A chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 1 / 1 | 
| P68371 | Tubulin beta-4B chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q13509 | Tubulin beta-3 chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 2 / 1 | 
| P68363 | Tubulin alpha-1B chain | Unclassified protein | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q13885 | Tubulin beta-2A chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q6PEY2 | Tubulin alpha-3E chain | Unclassified protein | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q9BQE3 | Tubulin alpha-1C chain | Unclassified protein | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q9BUF5 | Tubulin beta-6 chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 0 / 0 | 
| Q9BVA1 | Tubulin beta-2B chain | Structural | CHEMBL56309 | CHEMBL622599
                        (1) | 1 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #202300 | Adrenocortical carcinoma, hereditary; adcc | P04637 | 
| #614740 | Basal cell carcinoma, susceptibility to, 7; bcc7 | P04637 | 
| #114500 | Colorectal cancer; crc | P84022 | 
| #614039 | Cortical dysplasia, complex, with other brain malformations 1; cdcbm1 | Q13509 | 
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #128101 | Dystonia 4, torsion, autosomal dominant; dyt4 | P04350 | 
| #133239 | Esophageal cancer | P04637 | 
| #600638 | Fibrosis of extraocular muscles, congenital, 3a, with or without extraocular involvement; cfeom3a | Q13509 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #612438 | Leukodystrophy, hypomyelinating, 6; hld6 | P04350 | 
| #151623 | Li-fraumeni syndrome 1; lfs1 | P04637 | 
| #611603 | Lissencephaly 3; lis3 | Q71U36 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #211980 | Lung cancer | P04637 | 
| #613112 | Macrothrombocytopenia, autosomal dominant, tubb1-related | Q9H4B7 | 
| #607948 | Mycobacterium tuberculosis, susceptibility to | P11473 | 
| #260500 | Papilloma of choroid plexus; cpp | P04637 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| #610031 | Polymicrogyria, symmetric or asymmetric; pmgysa | Q9BVA1 | 
| #604906 | Schizophrenia 9; sczd9 | P49798 | 
| #181500 | Schizophrenia; sczd | P49798 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #275355 | Squamous cell carcinoma, head and neck; hnscc | P04637 | 
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a | P11473 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00004 | Chronic myeloid leukemia (CML) | P04637
                            (related) | 
| H00005 | Chronic lymphocytic leukemia (CLL) | P04637
                            (related) | 
| H00006 | Hairy-cell leukemia | P04637
                            (related) | 
| H00008 | Burkitt lymphoma | P04637
                            (related) | 
| H00009 | Adult T-cell leukemia | P04637
                            (related) | 
| H00010 | Multiple myeloma | P04637
                            (related) | 
| H00013 | Small cell lung cancer | P04637
                            (related) | 
| H00014 | Non-small cell lung cancer | P04637
                            (related) | 
| H00015 | Malignant pleural mesothelioma | P04637
                            (related) | 
| H00016 | Oral cancer | P04637
                            (related) P04637 (marker) | 
| H00017 | Esophageal cancer | P04637
                            (related) P04637 (marker) | 
| H00018 | Gastric cancer | P04637
                            (related) | 
| H00019 | Pancreatic cancer | P04637
                            (related) P04637 (marker) | 
| H00020 | Colorectal cancer | P04637
                            (related) P04637 (marker) | 
| H00022 | Bladder cancer | P04637
                            (related) | 
| H00025 | Penile cancer | P04637
                            (related) P04637 (marker) | 
| H00026 | Endometrial Cancer | P04637
                            (related) | 
| H00027 | Ovarian cancer | P04637
                            (related) | 
| H00028 | Choriocarcinoma | P04637
                            (related) | 
| H00029 | Vulvar cancer | P04637
                            (related) | 
| H00031 | Breast cancer | P04637
                            (related) | 
| H00032 | Thyroid cancer | P04637
                            (related) | 
| H00033 | Adrenal carcinoma | P04637
                            (related) | 
| H00036 | Osteosarcoma | P04637
                            (related) | 
| H00038 | Malignant melanoma | P04637
                            (related) | 
| H00039 | Basal cell carcinoma | P04637
                            (related) | 
| H00040 | Squamous cell carcinoma | P04637
                            (related) | 
| H00041 | Kaposi's sarcoma | P04637
                            (related) | 
| H00042 | Glioma | P04637
                            (related) P04637 (marker) | 
| H00044 | Cancer of the anal canal | P04637
                            (related) | 
| H00046 | Cholangiocarcinoma | P04637
                            (related) | 
| H00047 | Gallbladder cancer | P04637
                            (related) | 
| H00048 | Hepatocellular carcinoma | P04637
                            (related) | 
| H00055 | Laryngeal cancer | P04637
                            (related) P04637 (marker) | 
| H00881 | Li-Fraumeni syndrome | P04637
                            (related) | 
| H01007 | Choroid plexus papilloma | P04637
                            (related) | 
| H00021 | Renal cell carcinoma | P04637
                            (marker) | 
| H00342 | Tuberculosis | P11473
                            (related) | 
| H00784 | Localized autosomal recessive hypotrichosis | P11473
                            (related) | 
| H01143 | Vitamin D-dependent rickets | P11473
                            (related) | 
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00838 | Congenital fibrosis of the extraocular muscles (CFEOM) | Q13509
                            (related) | 
| H00268 | Lissencephaly (LIS) | Q71U36
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) |