| id | C00028165 |
|---|---|
| Name | Denudatine |
| CAS RN | 26166-37-0 |
| Standard InChI | InChI=1S/C22H33NO2/c1-4-23-11-20(3)7-5-8-22-15(20)10-14(18(22)23)21-9-6-13(12(2)19(21)25)16(24)17(21)22/h13-19,24-25H,2,4-11H2,1,3H3/t13-,14+,15-,16+,17-,18?,19-,20?,21+,22?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H33NO2/c1-4-23-11-20(3)7-5-8-22-15(20)10-14(18(22)23)21-9-6-13(12(2)19(21)25)16(24)17(21)22/h13-19,24-25H,2,4-11H2,1,3H3 |
| Phytochemical cluster | No. 10 |
|---|---|
| KCF-S cluster | No. 124 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C08680 |
|---|
| By CAS RN | C034767 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Ranunculaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aconitum nagarum var.heterotrichum | 49188 | Ranunculaceae | eudicotyledons | Viridiplantae |
| Delphinium denudatum Wall. | 46246 | Ranunculaceae | eudicotyledons | Viridiplantae |