| id | C00028180 |
|---|---|
| Name | Dibromophakellin |
| CAS RN | 63700-27-6 |
| Standard InChI | InChI=1S/C11H11Br2N5O/c12-5-4-6-8(19)17-3-1-2-11(17)9(15-10(14)16-11)18(6)7(5)13/h4,9H,1-3H2,(H3,14,15,16)/t9-,11+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H11Br2N5O/c12-5-4-6-8(19)17-3-1-2-11(17)9(15-10(14)16-11)18(6)7(5)13/h4,9H,1-3H2,(H3,14,15,16) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4018 |
| By standard InChI | CHEMBL447696 |
|---|---|
| By standard InChI Main Layer | CHEMBL447696 CHEMBL609329 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Axinellidae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Phakellia mauretiana | 85813 | Axinellidae | Metazoa | |
| Phakellia mauritiana | 85813 | Axinellidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL447696 |
CHEMBL957655
(1)
|
0 / 0 |