| id | C00002821 |
|---|---|
| Name | Eleutherin / (+)-Eleutherin |
| CAS RN | 478-36-4 |
| Standard InChI | InChI=1S/C16H16O4/c1-8-7-11-13(9(2)20-8)16(18)14-10(15(11)17)5-4-6-12(14)19-3/h4-6,8-9H,7H2,1-3H3/t8-,9+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H16O4/c1-8-7-11-13(9(2)20-8)16(18)14-10(15(11)17)5-4-6-12(14)19-3/h4-6,8-9H,7H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1191 |
| By standard InChI | CHEMBL594153 |
|---|---|
| By standard InChI Main Layer | CHEMBL594153 |
| By LinkDB | C10340 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| family name | count |
|---|---|
| Iridaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eleutherine americana MERR.et HEYNE | 58985 | Iridaceae | Liliopsida | Viridiplantae |
| Eleutherine bulbosa | 1210469 | Iridaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL594153 |
CHEMBL1065960
(1)
CHEMBL1065961
(1)
|
0 / 0 |