| id | C00002823 | 
|---|---|
| Name | Emodin 1-beta-D-glucopyranoside / 1-O-beta-D-glucopyranosyl emodin | 
| CAS RN | 38840-23-2 | 
| Standard InChI | InChI=1S/C21H20O10/c1-7-2-9-14(11(24)3-7)18(27)15-10(16(9)25)4-8(23)5-12(15)30-21-20(29)19(28)17(26)13(6-22)31-21/h2-5,13,17,19-24,26,28-29H,6H2,1H3/t13?,17-,19+,20?,21-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C21H20O10/c1-7-2-9-14(11(24)3-7)18(27)15-10(16(9)25)4-8(23)5-12(15)30-21-20(29)19(28)17(26)13(6-22)31-21/h2-5,13,17,19-24,26,28-29H,6H2,1H3 | 
| Phytochemical cluster | No. 62 | 
|---|---|
| KCF-S cluster | No. 568 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL464360 | 
| By LinkDB | C10345 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 1 | 
| family name | count | 
|---|---|
| Picramniaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Picramnia teapensis Tul. | 85238 | Picramniaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL464360 | CHEMBL677051
                        (1)
                        CHEMBL677223
                        (1) CHEMBL708330 (1) CHEMBL708331 (1) CHEMBL708332 (1) | 0 / 1 | 
| P03372 | Estrogen receptor | NR3A1 | CHEMBL464360 | CHEMBL679893
                        (1)
                        CHEMBL682303
                        (1) CHEMBL708330 (1) CHEMBL708331 (1) CHEMBL708332 (1) | 1 / 1 |