| id | C00028548 |
|---|---|
| Name | Makaluvamine D |
| CAS RN | 146555-81-9 |
| Standard InChI | InChI=1S/C18H17N3O2/c22-13-3-1-11(2-4-13)5-7-20-15-9-14-16-12(6-8-19-14)10-21-17(16)18(15)23/h1-4,9-10,20-22H,5-8H2 |
| Standard InChI (Main Layer) | InChI=1S/C18H17N3O2/c22-13-3-1-11(2-4-13)5-7-20-15-9-14-16-12(6-8-19-14)10-21-17(16)18(15)23/h1-4,9-10,20-22H,5-8H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1002 |
| By standard InChI | CHEMBL453817 |
|---|---|
| By standard InChI Main Layer | CHEMBL453817 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Zyzzya fuliginosa | 1346156 | Metazoa | ||
| Zyzzya sp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL453817 |
CHEMBL995331
(1)
|
0 / 0 |