id | C00028684 |
---|---|
Name | N-Formyl-N-deacetylcolchicine |
CAS RN | 7411-12-3 |
Standard InChI | InChI=1S/C21H23NO6/c1-25-17-8-6-13-14(10-16(17)24)15(22-11-23)7-5-12-9-18(26-2)20(27-3)21(28-4)19(12)13/h6,8-11,15H,5,7H2,1-4H3,(H,22,23)/t15-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C21H23NO6/c1-25-17-8-6-13-14(10-16(17)24)15(22-11-23)7-5-12-9-18(26-2)20(27-3)21(28-4)19(12)13/h6,8-11,15H,5,7H2,1-4H3,(H,22,23) |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 598 |
By standard InChI | CHEMBL85710 |
---|---|
By standard InChI Main Layer | CHEMBL85710 |
By LinkDB | C19981 |
---|
By CAS RN | C080994 |
---|
class name | count |
---|---|
Liliopsida | 10 |
family name | count |
---|---|
Colchicaceae | 10 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL85710 |
CHEMBL1738606
(1)
|
0 / 0 |