id | C00028703 |
---|---|
Name | N-Methyl-huperzine B |
CAS RN | 110037-64-4 |
Standard InChI | InChI=1S/C17H22N2O/c1-11-8-12-9-15-14(5-6-16(20)18-15)17(10-11)13(12)4-3-7-19(17)2/h5-6,8,12-13H,3-4,7,9-10H2,1-2H3,(H,18,20)/t12-,13+,17+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C17H22N2O/c1-11-8-12-9-15-14(5-6-16(20)18-15)17(10-11)13(12)4-3-7-19(17)2/h5-6,8,12-13H,3-4,7,9-10H2,1-2H3,(H,18,20) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1751 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL611808 |
By LinkDB |
---|
By CAS RN | C058369 |
---|
class name | count |
---|---|
Embryophyta | 1 |
family name | count |
---|---|
Lycopodiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Huperzia serrata | 355589 | Lycopodiaceae | Embryophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL611808 |
CHEMBL644119
(1)
CHEMBL684541
(1)
|
1 / 0 |