| id | C00002871 |
|---|---|
| Name | Batatasin IV / 2',3-Dihydroxy-5-methoxybibenzyl |
| CAS RN | 60347-67-3 |
| Standard InChI | InChI=1S/C15H16O3/c1-18-14-9-11(8-13(16)10-14)6-7-12-4-2-3-5-15(12)17/h2-5,8-10,16-17H,6-7H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H16O3/c1-18-14-9-11(8-13(16)10-14)6-7-12-4-2-3-5-15(12)17/h2-5,8-10,16-17H,6-7H2,1H3 |
| Phytochemical cluster | No. 26 |
|---|---|
| KCF-S cluster | No. 242 |
| By standard InChI | CHEMBL228126 |
|---|---|
| By standard InChI Main Layer | CHEMBL228126 |
| By LinkDB | C10247 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 4 |
| family name | count |
|---|---|
| Dioscoreaceae | 4 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dioscorea alata | 55571 | Dioscoreaceae | Liliopsida | Viridiplantae |
| Dioscorea batatas | 55575 | Dioscoreaceae | Liliopsida | Viridiplantae |
| Dioscorea opposita | 569628 | Dioscoreaceae | Liliopsida | Viridiplantae |
| Dioscorea rotundata | 55577 | Dioscoreaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL228126 |
CHEMBL914259
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL228126 |
CHEMBL914258
(1)
|
0 / 0 |