| id | C00028729 |
|---|---|
| Name | Noroxyhydrastinine |
| CAS RN | 21796-14-5 |
| Standard InChI | InChI=1S/C10H9NO3/c12-10-7-4-9-8(13-5-14-9)3-6(7)1-2-11-10/h3-4H,1-2,5H2,(H,11,12) |
| Standard InChI (Main Layer) | InChI=1S/C10H9NO3/c12-10-7-4-9-8(13-5-14-9)3-6(7)1-2-11-10/h3-4H,1-2,5H2,(H,11,12) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3603 |
| By standard InChI | CHEMBL449731 |
|---|---|
| By standard InChI Main Layer | CHEMBL449731 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Ranunculaceae | 1 |
| Papaveraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Fumaria indica | 200992 | Papaveraceae | eudicotyledons | Viridiplantae |
| Thalictrum minus L.var.adiantifolium | 46968 | Ranunculaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9NR56 | Muscleblind-like protein 1 | Unclassified protein | CHEMBL449731 |
CHEMBL1614166
(1)
|
1 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL449731 |
CHEMBL1794401
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL449731 |
CHEMBL1613914
(1)
|
0 / 0 |