id | C00028776 |
---|---|
Name | Oroidin |
CAS RN | 34649-22-4 |
Standard InChI | InChI=1S/C11H11Br2N5O/c12-7-4-8(18-9(7)13)10(19)15-3-1-2-6-5-16-11(14)17-6/h1-2,4-5,18H,3H2,(H,15,19)(H3,14,16,17)/b2-1+ |
Standard InChI (Main Layer) | InChI=1S/C11H11Br2N5O/c12-7-4-8(18-9(7)13)10(19)15-3-1-2-6-5-16-11(14)17-6/h1-2,4-5,18H,3H2,(H,15,19)(H3,14,16,17) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2659 |
By standard InChI | CHEMBL397591 |
---|---|
By standard InChI Main Layer | CHEMBL397591 |
By LinkDB |
---|
By CAS RN | C077209 |
---|
class name | count |
---|
family name | count |
---|---|
Axinellidae | 2 |
Agelasidae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Agelas sventres | 333314 | Agelasidae | Metazoa | |
Agelas wiedenmeyeri | ||||
Stylissa caribica | ||||
Stylissa carteri | 279588 | Axinellidae | Metazoa | |
Stylissa massa | 279589 | Axinellidae | Metazoa |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q02750 | Dual specificity mitogen-activated protein kinase kinase 1 | Ste7 | CHEMBL397591 |
CHEMBL731425
(1)
CHEMBL769165
(1)
|
1 / 1 |
P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL397591 |
CHEMBL729502
(1)
|
0 / 0 |
P04049 | RAF proto-oncogene serine/threonine-protein kinase | Raf | CHEMBL397591 |
CHEMBL769165
(1)
|
2 / 0 |