| id | C00028776 |
|---|---|
| Name | Oroidin |
| CAS RN | 34649-22-4 |
| Standard InChI | InChI=1S/C11H11Br2N5O/c12-7-4-8(18-9(7)13)10(19)15-3-1-2-6-5-16-11(14)17-6/h1-2,4-5,18H,3H2,(H,15,19)(H3,14,16,17)/b2-1+ |
| Standard InChI (Main Layer) | InChI=1S/C11H11Br2N5O/c12-7-4-8(18-9(7)13)10(19)15-3-1-2-6-5-16-11(14)17-6/h1-2,4-5,18H,3H2,(H,15,19)(H3,14,16,17) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2659 |
| By standard InChI | CHEMBL397591 |
|---|---|
| By standard InChI Main Layer | CHEMBL397591 |
| By LinkDB |
|---|
| By CAS RN | C077209 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Axinellidae | 2 |
| Agelasidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Agelas sventres | 333314 | Agelasidae | Metazoa | |
| Agelas wiedenmeyeri | ||||
| Stylissa caribica | ||||
| Stylissa carteri | 279588 | Axinellidae | Metazoa | |
| Stylissa massa | 279589 | Axinellidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q02750 | Dual specificity mitogen-activated protein kinase kinase 1 | Ste7 | CHEMBL397591 |
CHEMBL731425
(1)
CHEMBL769165
(1)
|
1 / 1 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL397591 |
CHEMBL729502
(1)
|
0 / 0 |
| P04049 | RAF proto-oncogene serine/threonine-protein kinase | Raf | CHEMBL397591 |
CHEMBL769165
(1)
|
2 / 0 |