id | C00029045 |
---|---|
Name | Stemofoline / (+)-Stemofoline |
CAS RN | 29881-57-0 |
Standard InChI | InChI=1S/C22H29NO5/c1-5-6-8-21-14-7-9-23(21)13-10-15(21)27-22(14)16(13)11(2)18(28-22)19-17(25-4)12(3)20(24)26-19/h11,13-16H,5-10H2,1-4H3/b19-18-/t11-,13?,14+,15-,16?,21-,22?/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C22H29NO5/c1-5-6-8-21-14-7-9-23(21)13-10-15(21)27-22(14)16(13)11(2)18(28-22)19-17(25-4)12(3)20(24)26-19/h11,13-16H,5-10H2,1-4H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 372 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1084524 CHEMBL2304257 |
By LinkDB |
---|
By CAS RN | C430220 |
---|
class name | count |
---|---|
Liliopsida | 7 |
family name | count |
---|---|
Stemonaceae | 7 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL2304257 |
CHEMBL1809351
(1)
|
1 / 0 |