| id | C00029065 |
|---|---|
| Name | Sutchuenenine |
| CAS RN | 151271-90-8 |
| Standard InChI | InChI=1S/C36H40N2O6/c1-37-15-13-24-19-32(42-3)31(40)21-28(24)29(37)17-23-7-11-27(12-8-23)44-36-33(43-4)20-25-14-16-38(2)30(34(25)35(36)41)18-22-5-9-26(39)10-6-22/h5-12,19-21,29-30,39-41H,13-18H2,1-4H3/t29-,30-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C36H40N2O6/c1-37-15-13-24-19-32(42-3)31(40)21-28(24)29(37)17-23-7-11-27(12-8-23)44-36-33(43-4)20-25-14-16-38(2)30(34(25)35(36)41)18-22-5-9-26(39)10-6-22/h5-12,19-21,29-30,39-41H,13-18H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 89 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cyclea sutchuensis | 152372 | Menispermaceae | eudicotyledons | Viridiplantae |