| id | C00029326 |
|---|---|
| Name | (5S)-5-Methoxy-1,7-diphenyl-3-heptanone |
| CAS RN | 103947-71-6 |
| Standard InChI | InChI=1S/C20H24O2/c1-22-20(15-13-18-10-6-3-7-11-18)16-19(21)14-12-17-8-4-2-5-9-17/h2-11,20H,12-16H2,1H3/t20-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O2/c1-22-20(15-13-18-10-6-3-7-11-18)16-19(21)14-12-17-8-4-2-5-9-17/h2-11,20H,12-16H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4937 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL240485 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Zingiberaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alpinia officinarum | 199623 | Zingiberaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL240485 |
CHEMBL966124
(1)
|
0 / 1 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL240485 |
CHEMBL961424
(1)
|
1 / 1 |