| id | C00029521 |
|---|---|
| Name | 4,6-Dihydroxy-2,3-dimethoxyxanthone |
| CAS RN | 929695-67-0 |
| Standard InChI | InChI=1S/C15H12O6/c1-19-11-6-9-12(17)8-4-3-7(16)5-10(8)21-14(9)13(18)15(11)20-2/h3-6,16,18H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H12O6/c1-19-11-6-9-12(17)8-4-3-7(16)5-10(8)21-14(9)13(18)15(11)20-2/h3-6,16,18H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hypericum chinense | 55962 | Hypericaceae | rosids | Viridiplantae |