| id | C00029566 |
|---|---|
| Name | 5-Hydroxy-1-methoxyxanthone |
| CAS RN | 27770-13-4 |
| Standard InChI | InChI=1S/C14H10O4/c1-17-10-6-3-7-11-12(10)13(16)8-4-2-5-9(15)14(8)18-11/h2-7,15H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C14H10O4/c1-17-10-6-3-7-11-12(10)13(16)8-4-2-5-9(15)14(8)18-11/h2-7,15H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 76 |
| By standard InChI | CHEMBL187159 |
|---|---|
| By standard InChI Main Layer | CHEMBL187159 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Calophyllaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Kayea assamica | 198769 | Calophyllaceae | rosids | Viridiplantae |
| Mammea siamensis | 231913 | Calophyllaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL187159 |
CHEMBL827909
(1)
|
1 / 1 |