| id | C00029602 |
|---|---|
| Name | 8-Geranyl-5-methoxypsoralen / 8-Geranyloxy-5-methoxypsoralen |
| CAS RN | 17182-52-4 |
| Standard InChI | InChI=1S/C22H24O5/c1-14(2)6-5-7-15(3)10-12-26-22-20-17(11-13-25-20)19(24-4)16-8-9-18(23)27-21(16)22/h6,8-11,13H,5,7,12H2,1-4H3/b15-10+ |
| Standard InChI (Main Layer) | InChI=1S/C22H24O5/c1-14(2)6-5-7-15(3)10-12-26-22-20-17(11-13-25-20)19(24-4)16-8-9-18(23)27-21(16)22/h6,8-11,13H,5,7,12H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1664 |
| By standard InChI | CHEMBL1934197 |
|---|---|
| By standard InChI Main Layer | CHEMBL1934197 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Heracleum candicans WALL. | 40917 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL1934197 |
CHEMBL1936881
(1)
|
0 / 0 |