| id | C00002964 |
|---|---|
| Name | Mesuaxanthone A |
| CAS RN | 3561-81-7 |
| Standard InChI | InChI=1S/C14H10O5/c1-18-7-5-10(16)12-11(6-7)19-14-8(13(12)17)3-2-4-9(14)15/h2-6,15-16H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C14H10O5/c1-18-7-5-10(16)12-11(6-7)19-14-8(13(12)17)3-2-4-9(14)15/h2-6,15-16H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL363747 |
|---|---|
| By standard InChI Main Layer | CHEMBL363747 |
| By LinkDB | C10081 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 5 |
| family name | count |
|---|---|
| Calophyllaceae | 4 |
| Clusiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Calophyllum fragrans | 73121 | Calophyllaceae | rosids | Viridiplantae |
| Calophyllum inophyllum | 158927 | Calophyllaceae | rosids | Viridiplantae |
| Garcinia spp. | 58227 | Clusiaceae | rosids | Viridiplantae |
| Mammea africana | 999584 | Calophyllaceae | rosids | Viridiplantae |
| Mesua ferrea | 210380 | Calophyllaceae | rosids | Viridiplantae |
| Symphonia spp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL363747 |
CHEMBL827909
(1)
|
1 / 1 |