id | C00002964 |
---|---|
Name | Mesuaxanthone A |
CAS RN | 3561-81-7 |
Standard InChI | InChI=1S/C14H10O5/c1-18-7-5-10(16)12-11(6-7)19-14-8(13(12)17)3-2-4-9(14)15/h2-6,15-16H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C14H10O5/c1-18-7-5-10(16)12-11(6-7)19-14-8(13(12)17)3-2-4-9(14)15/h2-6,15-16H,1H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 3 |
By standard InChI | CHEMBL363747 |
---|---|
By standard InChI Main Layer | CHEMBL363747 |
By LinkDB | C10081 |
---|
By CAS RN |
---|
class name | count |
---|---|
rosids | 5 |
family name | count |
---|---|
Calophyllaceae | 4 |
Clusiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Calophyllum fragrans | 73121 | Calophyllaceae | rosids | Viridiplantae |
Calophyllum inophyllum | 158927 | Calophyllaceae | rosids | Viridiplantae |
Garcinia spp. | 58227 | Clusiaceae | rosids | Viridiplantae |
Mammea africana | 999584 | Calophyllaceae | rosids | Viridiplantae |
Mesua ferrea | 210380 | Calophyllaceae | rosids | Viridiplantae |
Symphonia spp. |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL363747 |
CHEMBL827909
(1)
|
1 / 1 |