| id | C00029797 |
|---|---|
| Name | Bastadin 5 |
| CAS RN | 79067-75-7 |
| Standard InChI | InChI=1S/C34H27Br5N4O8/c35-20-7-16-1-2-27(20)50-28-14-17(8-21(36)30(28)44)4-6-41-33(46)25(42-48)12-18-10-23(38)32(24(39)11-18)51-29-15-19(9-22(37)31(29)45)13-26(43-49)34(47)40-5-3-16/h1-2,7-11,14-15,44-45,48-49H,3-6,12-13H2,(H,40,47)(H,41,46)/b42-25+,43-26+ |
| Standard InChI (Main Layer) | InChI=1S/C34H27Br5N4O8/c35-20-7-16-1-2-27(20)50-28-14-17(8-21(36)30(28)44)4-6-41-33(46)25(42-48)12-18-10-23(38)32(24(39)11-18)51-29-15-19(9-22(37)31(29)45)13-26(43-49)34(47)40-5-3-16/h1-2,7-11,14-15,44-45,48-49H,3-6,12-13H2,(H,40,47)(H,41,46) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 651 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL439151 |
| By LinkDB |
|---|
| By CAS RN | C105188 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Ianthellidae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ianthella basta | 375146 | Ianthellidae | Metazoa | |
| Ianthella quadrangulata | 1162752 | Ianthellidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21817 | Ryanodine receptor 1 | CA | CHEMBL439151 |
CHEMBL960265
(1)
CHEMBL1006192
(1)
|
4 / 2 |