| id | C00029994 |
|---|---|
| Name | Cnidimoside A |
| CAS RN | 155112-93-9 |
| Standard InChI | InChI=1S/C21H26O10/c1-9(8-29-21-20(28)19(27)18(26)15(7-22)31-21)3-4-11-12(23)6-14-16(17(11)25)13(24)5-10(2)30-14/h3,5-6,15,18-23,25-28H,4,7-8H2,1-2H3/b9-3-/t15-,18-,19+,20-,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H26O10/c1-9(8-29-21-20(28)19(27)18(26)15(7-22)31-21)3-4-11-12(23)6-14-16(17(11)25)13(24)5-10(2)30-14/h3,5-6,15,18-23,25-28H,4,7-8H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1013 |
| By standard InChI | CHEMBL2087917 |
|---|---|
| By standard InChI Main Layer | CHEMBL1329158 CHEMBL2087917 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cnidium japonicum | 48111 | Apiaceae | asterids | Viridiplantae |
| Cnidium monnieri | 94007 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL1329158 |
CHEMBL1794569
(1)
|
1 / 1 |