id | C00030167 |
---|---|
Name | Eleutheroside B |
CAS RN | 118-34-3 |
Standard InChI | InChI=1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3/b4-3+/t12-,13-,14+,15-,17+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3 |
Phytochemical cluster | No. 6 |
---|---|
KCF-S cluster | No. 678 |
By standard InChI | CHEMBL250872 |
---|---|
By standard InChI Main Layer | CHEMBL250872 |
By LinkDB | C01533 |
---|
By CAS RN | C028305 |
---|
class name | count |
---|---|
asterids | 1 |
family name | count |
---|---|
Araliaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Acanthopanax senticosus | 82096 | Araliaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL250872 |
CHEMBL1008496
(1)
|
0 / 0 |