| id | C00030189 |
|---|---|
| Name | epi-alpha-Selinene |
| CAS RN | 35387-23-6 |
| Standard InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 151 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Caprifoliaceae | 2 |
| Cyperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cyperus rotundus | 512623 | Cyperaceae | Liliopsida | Viridiplantae |
| Nardostachys chinensis | 179860 | Caprifoliaceae | asterids | Viridiplantae |
| Nardostachys grandiflora | 768052 | Caprifoliaceae | asterids | Viridiplantae |