| id | C00030226 |
|---|---|
| Name | Eugenin |
| CAS RN | 480-34-2 |
| Standard InChI | InChI=1S/C11H10O4/c1-6-3-8(12)11-9(13)4-7(14-2)5-10(11)15-6/h3-5,13H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C11H10O4/c1-6-3-8(12)11-9(13)4-7(14-2)5-10(11)15-6/h3-5,13H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2463 |
| By standard InChI | CHEMBL446974 |
|---|---|
| By standard InChI Main Layer | CHEMBL446974 |
| By LinkDB | C20210 |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Myrtaceae | 1 |
| Apiaceae | 1 |
| Simaroubaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bupleurum scorzonerifolium | 48105 | Apiaceae | asterids | Viridiplantae |
| Eugenia jambolana | 260142 | Myrtaceae | rosids | Viridiplantae |
| Harrisonia perforata | 43717 | Simaroubaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL446974 |
CHEMBL1686537
(1)
CHEMBL1686539
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL446974 |
CHEMBL1686536
(1)
CHEMBL1686538
(1)
|
0 / 0 |