| id | C00030347 |
|---|---|
| Name | gamma-Dodecalactone |
| CAS RN | 2305-05-7 |
| Standard InChI | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h11H,2-10H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h11H,2-10H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1374 |
| By standard InChI | CHEMBL195215 |
|---|---|
| By standard InChI Main Layer | CHEMBL195215 CHEMBL1269378 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Anthemis aciphylla BOISS.var.discoidea BOISS | 99027 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL195215 |
CHEMBL830921
(1)
|
0 / 0 |