id | C00030824 |
---|---|
Name | Nirtetralin / (+)-Nirtetralin |
CAS RN | 50656-78-5 |
Standard InChI | InChI=1S/C24H30O7/c1-25-11-16-8-15-10-20-23(31-13-30-20)24(29-5)22(15)21(17(16)12-26-2)14-6-7-18(27-3)19(9-14)28-4/h6-7,9-10,16-17,21H,8,11-13H2,1-5H3/t16-,17-,21+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C24H30O7/c1-25-11-16-8-15-10-20-23(31-13-30-20)24(29-5)22(15)21(17(16)12-26-2)14-6-7-18(27-3)19(9-14)28-4/h6-7,9-10,16-17,21H,8,11-13H2,1-5H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1105 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL453822 |
By LinkDB |
---|
By CAS RN | C475933 |
---|
family name | count |
---|---|
Phyllanthaceae | 2 |
Plantaginaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Phyllanthus niruri | 296034 | Phyllanthaceae | rosids | Viridiplantae |
Phyllanthus urinaria L. | 296035 | Phyllanthaceae | rosids | Viridiplantae |
Scoparia dulcis L. | 107240 | Plantaginaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P24530 | Endothelin B receptor | Endothelin receptor | CHEMBL453822 |
CHEMBL937908
(1)
|
4 / 4 |
P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL453822 |
CHEMBL937907
(1)
|
0 / 0 |