| id | C00031018 |
|---|---|
| Name | Phyllanthusmin C / (-)-Phyllanthusmin C |
| CAS RN | 914639-26-2 |
| Standard InChI | InChI=1S/C26H24O11/c1-31-17-6-12-13(7-18(17)32-2)24(37-26-23(29)22(28)15(27)9-34-26)14-8-33-25(30)21(14)20(12)11-3-4-16-19(5-11)36-10-35-16/h3-7,15,22-23,26-29H,8-10H2,1-2H3/t15-,22-,23+,26-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H24O11/c1-31-17-6-12-13(7-18(17)32-2)24(37-26-23(29)22(28)15(27)9-34-26)14-8-33-25(30)21(14)20(12)11-3-4-16-19(5-11)36-10-35-16/h3-7,15,22-23,26-29H,8-10H2,1-2H3 |
| Phytochemical cluster | No. 22 |
|---|---|
| KCF-S cluster | No. 509 |
| By standard InChI | CHEMBL460047 |
|---|---|
| By standard InChI Main Layer | CHEMBL460047 CHEMBL1929098 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Phyllanthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Phyllanthus oligospermus | 586100 | Phyllanthaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL460047 CHEMBL1929098 |
CHEMBL1930896
(2)
|
0 / 0 |