id | C00031032 |
---|---|
Name | Pinoresinol diglucoside / (-)-Pinoresinol diglucoside |
CAS RN | 63902-38-5 |
Standard InChI | InChI=1S/C32H42O16/c1-41-19-7-13(3-5-17(19)45-31-27(39)25(37)23(35)21(9-33)47-31)29-15-11-44-30(16(15)12-43-29)14-4-6-18(20(8-14)42-2)46-32-28(40)26(38)24(36)22(10-34)48-32/h3-8,15-16,21-40H,9-12H2,1-2H3/t15-,16-,21+,22+,23+,24+,25-,26-,27+,28+,29+,30+,31+,32+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C32H42O16/c1-41-19-7-13(3-5-17(19)45-31-27(39)25(37)23(35)21(9-33)47-31)29-15-11-44-30(16(15)12-43-29)14-4-6-18(20(8-14)42-2)46-32-28(40)26(38)24(36)22(10-34)48-32/h3-8,15-16,21-40H,9-12H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 152 |
By standard InChI | CHEMBL450911 |
---|---|
By standard InChI Main Layer | CHEMBL450911 CHEMBL573785 CHEMBL1712579 |
By LinkDB |
---|
By CAS RN | C013200 |
---|
class name | count |
---|
family name | count |
---|---|
Enterococcaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Enterococcus faecalis | 1351 | Enterococcaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O75496 | Geminin | Unclassified protein | CHEMBL1712579 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1712579 |
CHEMBL1738588
(1)
|
0 / 0 |