| id | C00031476 |
|---|---|
| Name | (S)-N-(1-Hydroxymethyl-2-phenylethyl)-benzamide / (-)-N-[(1S)-1-(Hydroxymethyl)-2-phenylethyl]-benzamide |
| CAS RN | 4503-96-2 |
| Standard InChI | InChI=1S/C16H17NO2/c18-12-15(11-13-7-3-1-4-8-13)17-16(19)14-9-5-2-6-10-14/h1-10,15,18H,11-12H2,(H,17,19)/t15-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H17NO2/c18-12-15(11-13-7-3-1-4-8-13)17-16(19)14-9-5-2-6-10-14/h1-10,15,18H,11-12H2,(H,17,19) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2550 |
| By standard InChI | CHEMBL469704 |
|---|---|
| By standard InChI Main Layer | CHEMBL469704 CHEMBL1731675 |
| By LinkDB |
|---|
| By CAS RN | C014358 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Begoniaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Begonia nantoensis | 78253 | Begoniaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL469704 |
CHEMBL941113
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1731675 |
CHEMBL1794483
(1)
|
0 / 0 |