| id | C00031536 |
|---|---|
| Name | 2',4'-Dihydroxy-6'-methoxychalcone |
| CAS RN | 18956-16-6 |
| Standard InChI | InChI=1S/C16H14O4/c1-20-15-10-12(17)9-14(19)16(15)13(18)8-7-11-5-3-2-4-6-11/h2-10,17,19H,1H3/b8-7+ |
| Standard InChI (Main Layer) | InChI=1S/C16H14O4/c1-20-15-10-12(17)9-14(19)16(15)13(18)8-7-11-5-3-2-4-6-11/h2-10,17,19H,1H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 92 |
| By standard InChI | CHEMBL378104 |
|---|---|
| By standard InChI Main Layer | CHEMBL378104 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Zingiberaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alpinia pinnanensis | 125262 | Zingiberaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL378104 |
CHEMBL1738312
(1)
|
0 / 0 |
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL378104 |
CHEMBL2114784
(1)
|
1 / 1 |
| P22001 | Potassium voltage-gated channel subfamily A member 3 | KCNA, Kv1.x (Shaker) | CHEMBL378104 |
CHEMBL1291810
(1)
CHEMBL1291811
(1)
|
0 / 0 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL378104 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL378104 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL378104 |
CHEMBL2114817
(1)
|
7 / 3 |
| Q9HC16 | DNA dC->dU-editing enzyme APOBEC-3G | Enzyme | CHEMBL378104 |
CHEMBL1963863
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL378104 |
CHEMBL1794483
(1)
|
0 / 0 |
| Q6W5P4 | Neuropeptide S receptor | Neuropeptide receptor | CHEMBL378104 |
CHEMBL1614052
(1)
|
1 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL378104 |
CHEMBL1737991
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL378104 |
CHEMBL1614421
(1)
|
4 / 3 |
| O00255 | Menin | Unclassified protein | CHEMBL378104 |
CHEMBL1614257
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL378104 |
CHEMBL1614257
(1)
|
1 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah |
P63092
|
| #608584 | Asthma-related traits, susceptibility to, 2 |
Q6W5P4
|
| #114500 | Colorectal cancer; crc |
P84022
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #174800 | Mccune-albright syndrome; mas |
P63092
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #166350 | Osseous heteroplasia, progressive; poh |
P63092
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #102200 | Pituitary adenoma, growth hormone-secreting |
P63092
|
| #103580 | Pseudohypoparathyroidism, type ia; php1a |
P63092
|
| #603233 | Pseudohypoparathyroidism, type ib; php1b |
P63092
|
| #612462 | Pseudohypoparathyroidism, type ic; php1c |
P63092
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00244 | Pseudohypoparathyroidism |
P63092
(related)
|
| H00441 | Progressive osseous heteroplasia (POH) |
P63092
(related)
|
| H00501 | Fibrous dysplasia, polyostotic |
P63092
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| H00063 | Spinocerebellar ataxia (SCA) |
Q99700
(related)
|