id | C00003175 |
---|---|
Name | Polygodial / (-)-Polygodial |
CAS RN | 6754-20-7 |
Standard InChI | InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3/t12-,13-,15+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3 |
Phytochemical cluster | No. 38 |
---|---|
KCF-S cluster | No. 2644 |
By standard InChI | CHEMBL254550 |
---|---|
By standard InChI Main Layer | CHEMBL218100 CHEMBL254550 |
By LinkDB | C09712 |
---|
By CAS RN | C034380 |
---|
class name | count |
---|---|
Magnoliophyta | 7 |
Euphyllophyta | 1 |
Embryophyta | 1 |
eudicotyledons | 1 |
family name | count |
---|---|
Canellaceae | 4 |
Dendrodorididae | 3 |
Winteraceae | 3 |
Blechnaceae | 1 |
Porellaceae | 1 |
Polygonaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O75762 | Transient receptor potential cation channel subfamily A member 1 | Unclassified protein | CHEMBL254550 |
CHEMBL1118238
(1)
|
1 / 0 |
O43451 | Maltase-glucoamylase, intestinal | Hydrolase | CHEMBL218100 |
CHEMBL856853
(1)
|
0 / 0 |